C15H16Cl2N2O2S — CID 24510307
(5E)-5-[(2,4-dichlorophenyl)methylidene]-3-(3-ethoxypropyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 24510307) has the molecular formula C15H16Cl2N2O2S and a molecular weight of 359.28 g/mol. Its IUPAC name is (5E)-5-[(2,4-dichlorophenyl)methylidene]-3-(3-ethoxypropyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(2,4-dichlorophenyl)methylidene]-3-(3-ethoxypropyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 24510307 |
| Molecular Formula | C15H16Cl2N2O2S |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | (5E)-5-[(2,4-dichlorophenyl)methylidene]-3-(3-ethoxypropyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOCCCN1C(=O)/C(=C\c2ccc(Cl)cc2Cl)NC1=S |
| InChI | InChI=1S/C15H16Cl2N2O2S/c1-2-21-7-3-6-19-14(20)13(18-15(19)22)8-10-4-5-11(16)9-12(10)17/h4-5,8-9H,2-3,6-7H2,1H3,(H,18,22)/b13-8+ |
| InChIKey | NLHDKOVILQEAMT-MDWZMJQESA-N |
| XLogP | 3.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|