C21H27ClN4O4S — CID 24510641
N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]-2-[3-(diethylsulfamoyl)anilino]acetamide (PubChem CID 24510641) has the molecular formula C21H27ClN4O4S and a molecular weight of 466.99 g/mol. Its IUPAC name is N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]-2-[3-(diethylsulfamoyl)anilino]acetamide.
| Compound Name | N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]-2-[3-(diethylsulfamoyl)anilino]acetamide |
|---|---|
| PubChem CID | 24510641 |
| Molecular Formula | C21H27ClN4O4S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]-2-[3-(diethylsulfamoyl)anilino]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(NCC(=O)NCC(=O)Nc2cccc(Cl)c2C)c1 |
| InChI | InChI=1S/C21H27ClN4O4S/c1-4-26(5-2)31(29,30)17-9-6-8-16(12-17)23-13-20(27)24-14-21(28)25-19-11-7-10-18(22)15(19)3/h6-12,23H,4-5,13-14H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | ASYIWGGXCKWZLN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |