C17H28N4O4S — CID 18096539
2-[3-(diethylsulfamoyl)anilino]-N-(2-methylpropylcarbamoyl)acetamide (PubChem CID 18096539) has the molecular formula C17H28N4O4S and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-[3-(diethylsulfamoyl)anilino]-N-(2-methylpropylcarbamoyl)acetamide.
| Compound Name | 2-[3-(diethylsulfamoyl)anilino]-N-(2-methylpropylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 18096539 |
| Molecular Formula | C17H28N4O4S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-[3-(diethylsulfamoyl)anilino]-N-(2-methylpropylcarbamoyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(NCC(=O)NC(=O)NCC(C)C)c1 |
| InChI | InChI=1S/C17H28N4O4S/c1-5-21(6-2)26(24,25)15-9-7-8-14(10-15)18-12-16(22)20-17(23)19-11-13(3)4/h7-10,13,18H,5-6,11-12H2,1-4H3,(H2,19,20,22,23) |
| InChIKey | GGNADQGBSRNAJE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |