C18H19N3O — CID 2451304
N'-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)pyridine-3-carbohydrazide (PubChem CID 2451304) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is N'-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)pyridine-3-carbohydrazide.
| Compound Name | N'-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 2451304 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N'-(5,7-dimethyl-3,4-dihydronaphthalen-1-yl)pyridine-3-carbohydrazide |
| SMILES | Cc1cc(C)c2c(c1)C(NNC(=O)c1cccnc1)=CCC2 |
| InChI | InChI=1S/C18H19N3O/c1-12-9-13(2)15-6-3-7-17(16(15)10-12)20-21-18(22)14-5-4-8-19-11-14/h4-5,7-11,20H,3,6H2,1-2H3,(H,21,22) |
| InChIKey | MQTLJTKYTDHDHJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|