C27H34ClN3O3 — CID 24513771
1-butyl-5-[4-(3-chlorophenyl)piperazine-1-carbonyl]-6-(2-methoxyphenyl)piperidin-2-one (PubChem CID 24513771) has the molecular formula C27H34ClN3O3 and a molecular weight of 484.04 g/mol. Its IUPAC name is 1-butyl-5-[4-(3-chlorophenyl)piperazine-1-carbonyl]-6-(2-methoxyphenyl)piperidin-2-one.
| Compound Name | 1-butyl-5-[4-(3-chlorophenyl)piperazine-1-carbonyl]-6-(2-methoxyphenyl)piperidin-2-one |
|---|---|
| PubChem CID | 24513771 |
| Molecular Formula | C27H34ClN3O3 |
| Molecular Weight | 484.04 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 1-butyl-5-[4-(3-chlorophenyl)piperazine-1-carbonyl]-6-(2-methoxyphenyl)piperidin-2-one |
| SMILES | CCCCN1C(=O)CCC(C(=O)N2CCN(c3cccc(Cl)c3)CC2)C1c1ccccc1OC |
| InChI | InChI=1S/C27H34ClN3O3/c1-3-4-14-31-25(32)13-12-23(26(31)22-10-5-6-11-24(22)34-2)27(33)30-17-15-29(16-18-30)21-9-7-8-20(28)19-21/h5-11,19,23,26H,3-4,12-18H2,1-2H3 |
| InChIKey | DTHJWGIBLLGYPM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.04 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |