C22H20N4O3S — CID 24515758
1-methyl-N'-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoyl]indole-3-carbohydrazide (PubChem CID 24515758) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is 1-methyl-N'-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoyl]indole-3-carbohydrazide.
| Compound Name | 1-methyl-N'-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoyl]indole-3-carbohydrazide |
|---|---|
| PubChem CID | 24515758 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 1-methyl-N'-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoyl]indole-3-carbohydrazide |
| SMILES | Cc1nc(COc2ccccc2C(=O)NNC(=O)c2cn(C)c3ccccc23)cs1 |
| InChI | InChI=1S/C22H20N4O3S/c1-14-23-15(13-30-14)12-29-20-10-6-4-8-17(20)21(27)24-25-22(28)18-11-26(2)19-9-5-3-7-16(18)19/h3-11,13H,12H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | VETZVRYXCQCJEM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|