C15H14N2O2S — CID 24641781
2-[(2-methyl-1,3-thiazol-4-yl)methoxy]-N-prop-2-ynylbenzamide (PubChem CID 24641781) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-thiazol-4-yl)methoxy]-N-prop-2-ynylbenzamide.
| Compound Name | 2-[(2-methyl-1,3-thiazol-4-yl)methoxy]-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 24641781 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-[(2-methyl-1,3-thiazol-4-yl)methoxy]-N-prop-2-ynylbenzamide |
| SMILES | C#CCNC(=O)c1ccccc1OCc1csc(C)n1 |
| InChI | InChI=1S/C15H14N2O2S/c1-3-8-16-15(18)13-6-4-5-7-14(13)19-9-12-10-20-11(2)17-12/h1,4-7,10H,8-9H2,2H3,(H,16,18) |
| InChIKey | VZVOQFRWTXVIEQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|