C23H25N3O8 — CID 24517030
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 24517030) has the molecular formula C23H25N3O8 and a molecular weight of 471.47 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 24517030 |
| Molecular Formula | C23H25N3O8 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1cc(CCNC(=O)C2CC(=O)N(c3ccc4c(c3)OCCO4)C2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C23H25N3O8/c1-31-19-9-14(17(26(29)30)12-20(19)32-2)5-6-24-23(28)15-10-22(27)25(13-15)16-3-4-18-21(11-16)34-8-7-33-18/h3-4,9,11-12,15H,5-8,10,13H2,1-2H3,(H,24,28) |
| InChIKey | WNUOORDRWMJMGL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|