C21H20ClNO3 — CID 24517923
(6-chloro-2H-chromen-3-yl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone (PubChem CID 24517923) has the molecular formula C21H20ClNO3 and a molecular weight of 369.85 g/mol. Its IUPAC name is (6-chloro-2H-chromen-3-yl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone.
| Compound Name | (6-chloro-2H-chromen-3-yl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 24517923 |
| Molecular Formula | C21H20ClNO3 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (6-chloro-2H-chromen-3-yl)-[2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone |
| SMILES | COc1ccc(C2CCCN2C(=O)C2=Cc3cc(Cl)ccc3OC2)cc1 |
| InChI | InChI=1S/C21H20ClNO3/c1-25-18-7-4-14(5-8-18)19-3-2-10-23(19)21(24)16-11-15-12-17(22)6-9-20(15)26-13-16/h4-9,11-12,19H,2-3,10,13H2,1H3 |
| InChIKey | JSMYVFVSPHRNPC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |