C17H14ClN3O3S2 — CID 24519423
2-[[5-(3-chloro-4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone (PubChem CID 24519423) has the molecular formula C17H14ClN3O3S2 and a molecular weight of 407.90 g/mol. Its IUPAC name is 2-[[5-(3-chloro-4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone.
| Compound Name | 2-[[5-(3-chloro-4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 24519423 |
| Molecular Formula | C17H14ClN3O3S2 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | 2-[[5-(3-chloro-4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone |
| SMILES | Cc1ccc(Nc2nnc(SCC(=O)c3ccc(O)c(O)c3)s2)cc1Cl |
| InChI | InChI=1S/C17H14ClN3O3S2/c1-9-2-4-11(7-12(9)18)19-16-20-21-17(26-16)25-8-15(24)10-3-5-13(22)14(23)6-10/h2-7,22-23H,8H2,1H3,(H,19,20) |
| InChIKey | DRHXJBYMGZLNQV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|