C17H15N3O3S2 — CID 7855249
2-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone (PubChem CID 7855249) has the molecular formula C17H15N3O3S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone.
| Compound Name | 2-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 7855249 |
| Molecular Formula | C17H15N3O3S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 2-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone |
| SMILES | O=C(CSc1nnc(NCc2ccccc2)s1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H15N3O3S2/c21-13-7-6-12(8-14(13)22)15(23)10-24-17-20-19-16(25-17)18-9-11-4-2-1-3-5-11/h1-8,21-22H,9-10H2,(H,18,19) |
| InChIKey | KMDWSLCWBQSWPW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|