C20H15ClFN3O2 — CID 24520323
3-[(2-chloroquinolin-3-yl)methyl]-5-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 24520323) has the molecular formula C20H15ClFN3O2 and a molecular weight of 383.81 g/mol. Its IUPAC name is 3-[(2-chloroquinolin-3-yl)methyl]-5-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(2-chloroquinolin-3-yl)methyl]-5-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24520323 |
| Molecular Formula | C20H15ClFN3O2 |
| Molecular Weight | 383.81 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 3-[(2-chloroquinolin-3-yl)methyl]-5-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(F)cc2)NC(=O)N(Cc2cc3ccccc3nc2Cl)C1=O |
| InChI | InChI=1S/C20H15ClFN3O2/c1-20(14-6-8-15(22)9-7-14)18(26)25(19(27)24-20)11-13-10-12-4-2-3-5-16(12)23-17(13)21/h2-10H,11H2,1H3,(H,24,27) |
| InChIKey | CXDUGSQSAVNNKD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|