C19H15F3N4O2 — CID 42952401
3-[[1-(difluoromethyl)benzimidazol-2-yl]methyl]-5-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 42952401) has the molecular formula C19H15F3N4O2 and a molecular weight of 388.35 g/mol. Its IUPAC name is 3-[[1-(difluoromethyl)benzimidazol-2-yl]methyl]-5-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[[1-(difluoromethyl)benzimidazol-2-yl]methyl]-5-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42952401 |
| Molecular Formula | C19H15F3N4O2 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3-[[1-(difluoromethyl)benzimidazol-2-yl]methyl]-5-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(F)cc2)NC(=O)N(Cc2nc3ccccc3n2C(F)F)C1=O |
| InChI | InChI=1S/C19H15F3N4O2/c1-19(11-6-8-12(20)9-7-11)16(27)25(18(28)24-19)10-15-23-13-4-2-3-5-14(13)26(15)17(21)22/h2-9,17H,10H2,1H3,(H,24,28) |
| InChIKey | IMJQUDFHBLQIDM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|