C19H15F2N5O4 — CID 25348218
(5S)-3-[[1-(difluoromethyl)benzimidazol-2-yl]methyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione (PubChem CID 25348218) has the molecular formula C19H15F2N5O4 and a molecular weight of 415.36 g/mol. Its IUPAC name is (5S)-3-[[1-(difluoromethyl)benzimidazol-2-yl]methyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[[1-(difluoromethyl)benzimidazol-2-yl]methyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 25348218 |
| Molecular Formula | C19H15F2N5O4 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (5S)-3-[[1-(difluoromethyl)benzimidazol-2-yl]methyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2ccc([N+](=O)[O-])cc2)NC(=O)N(Cc2nc3ccccc3n2C(F)F)C1=O |
| InChI | InChI=1S/C19H15F2N5O4/c1-19(11-6-8-12(9-7-11)26(29)30)16(27)24(18(28)23-19)10-15-22-13-4-2-3-5-14(13)25(15)17(20)21/h2-9,17H,10H2,1H3,(H,23,28)/t19-/m0/s1 |
| InChIKey | QLECMRKXHNUWMT-IBGZPJMESA-N |
| XLogP | 3.31 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|