C15H10F5N3O — CID 39041789
1-[[1-(difluoromethyl)benzimidazol-2-yl]methyl]-3-(trifluoromethyl)pyridin-2-one (PubChem CID 39041789) has the molecular formula C15H10F5N3O and a molecular weight of 343.26 g/mol. Its IUPAC name is 1-[[1-(difluoromethyl)benzimidazol-2-yl]methyl]-3-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[[1-(difluoromethyl)benzimidazol-2-yl]methyl]-3-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 39041789 |
| Molecular Formula | C15H10F5N3O |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 1-[[1-(difluoromethyl)benzimidazol-2-yl]methyl]-3-(trifluoromethyl)pyridin-2-one |
| SMILES | O=c1c(C(F)(F)F)cccn1Cc1nc2ccccc2n1C(F)F |
| InChI | InChI=1S/C15H10F5N3O/c16-14(17)23-11-6-2-1-5-10(11)21-12(23)8-22-7-3-4-9(13(22)24)15(18,19)20/h1-7,14H,8H2 |
| InChIKey | ZCQFLVRIYGNMJF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |