C21H18ClNO5 — CID 24524756
2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-(4-methyl-2-oxochromen-7-yl)acetamide (PubChem CID 24524756) has the molecular formula C21H18ClNO5 and a molecular weight of 399.83 g/mol. Its IUPAC name is 2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-(4-methyl-2-oxochromen-7-yl)acetamide.
| Compound Name | 2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-(4-methyl-2-oxochromen-7-yl)acetamide |
|---|---|
| PubChem CID | 24524756 |
| Molecular Formula | C21H18ClNO5 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-(4-methyl-2-oxochromen-7-yl)acetamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)Cc3cc(Cl)c4c(c3)OCCCO4)ccc12 |
| InChI | InChI=1S/C21H18ClNO5/c1-12-7-20(25)28-17-11-14(3-4-15(12)17)23-19(24)10-13-8-16(22)21-18(9-13)26-5-2-6-27-21/h3-4,7-9,11H,2,5-6,10H2,1H3,(H,23,24) |
| InChIKey | HVONUXPFUMUDQK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|