C22H19F3N2O4S — CID 24525403
4-[methyl-(4-methylphenyl)sulfonylamino]-N-[2-(trifluoromethoxy)phenyl]benzamide (PubChem CID 24525403) has the molecular formula C22H19F3N2O4S and a molecular weight of 464.47 g/mol. Its IUPAC name is 4-[methyl-(4-methylphenyl)sulfonylamino]-N-[2-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 4-[methyl-(4-methylphenyl)sulfonylamino]-N-[2-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 24525403 |
| Molecular Formula | C22H19F3N2O4S |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 4-[methyl-(4-methylphenyl)sulfonylamino]-N-[2-(trifluoromethoxy)phenyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc(C(=O)Nc3ccccc3OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H19F3N2O4S/c1-15-7-13-18(14-8-15)32(29,30)27(2)17-11-9-16(10-12-17)21(28)26-19-5-3-4-6-20(19)31-22(23,24)25/h3-14H,1-2H3,(H,26,28) |
| InChIKey | WBMQGRIQJUNNDN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |