C21H22FN3O6S — CID 24526048
2-(5-fluoro-2-nitrophenoxy)-1-(6-pyrrolidin-1-ylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)ethanone (PubChem CID 24526048) has the molecular formula C21H22FN3O6S and a molecular weight of 463.49 g/mol. Its IUPAC name is 2-(5-fluoro-2-nitrophenoxy)-1-(6-pyrrolidin-1-ylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)ethanone.
| Compound Name | 2-(5-fluoro-2-nitrophenoxy)-1-(6-pyrrolidin-1-ylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)ethanone |
|---|---|
| PubChem CID | 24526048 |
| Molecular Formula | C21H22FN3O6S |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 2-(5-fluoro-2-nitrophenoxy)-1-(6-pyrrolidin-1-ylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)ethanone |
| SMILES | O=C(COc1cc(F)ccc1[N+](=O)[O-])N1CCCc2cc(S(=O)(=O)N3CCCC3)ccc21 |
| InChI | InChI=1S/C21H22FN3O6S/c22-16-5-7-19(25(27)28)20(13-16)31-14-21(26)24-11-3-4-15-12-17(6-8-18(15)24)32(29,30)23-9-1-2-10-23/h5-8,12-13H,1-4,9-11,14H2 |
| InChIKey | LGXLOJFEHHYHCJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|