C13H16FN3O6S — CID 27914613
2-(5-fluoro-2-nitrophenoxy)-1-(4-methylsulfonylpiperazin-1-yl)ethanone (PubChem CID 27914613) has the molecular formula C13H16FN3O6S and a molecular weight of 361.35 g/mol. Its IUPAC name is 2-(5-fluoro-2-nitrophenoxy)-1-(4-methylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 2-(5-fluoro-2-nitrophenoxy)-1-(4-methylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 27914613 |
| Molecular Formula | C13H16FN3O6S |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-(5-fluoro-2-nitrophenoxy)-1-(4-methylsulfonylpiperazin-1-yl)ethanone |
| SMILES | CS(=O)(=O)N1CCN(C(=O)COc2cc(F)ccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H16FN3O6S/c1-24(21,22)16-6-4-15(5-7-16)13(18)9-23-12-8-10(14)2-3-11(12)17(19)20/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | GVZMAXYSLWSMJP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|