C18H18Cl2N2O3S — CID 24526878
3-(N-[2-(2,5-dichlorophenyl)sulfanylacetyl]-4-methoxyanilino)propanamide (PubChem CID 24526878) has the molecular formula C18H18Cl2N2O3S and a molecular weight of 413.33 g/mol. Its IUPAC name is 3-(N-[2-(2,5-dichlorophenyl)sulfanylacetyl]-4-methoxyanilino)propanamide.
| Compound Name | 3-(N-[2-(2,5-dichlorophenyl)sulfanylacetyl]-4-methoxyanilino)propanamide |
|---|---|
| PubChem CID | 24526878 |
| Molecular Formula | C18H18Cl2N2O3S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 3-(N-[2-(2,5-dichlorophenyl)sulfanylacetyl]-4-methoxyanilino)propanamide |
| SMILES | COc1ccc(N(CCC(N)=O)C(=O)CSc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O3S/c1-25-14-5-3-13(4-6-14)22(9-8-17(21)23)18(24)11-26-16-10-12(19)2-7-15(16)20/h2-7,10H,8-9,11H2,1H3,(H2,21,23) |
| InChIKey | KCWSEVRDXPTSAK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |