C22H15N5O3S — CID 24526913
4-(benzimidazolo[1,2-c]quinazolin-6-ylsulfanylmethyl)-3-nitrobenzamide (PubChem CID 24526913) has the molecular formula C22H15N5O3S and a molecular weight of 429.46 g/mol. Its IUPAC name is 4-(benzimidazolo[1,2-c]quinazolin-6-ylsulfanylmethyl)-3-nitrobenzamide.
| Compound Name | 4-(benzimidazolo[1,2-c]quinazolin-6-ylsulfanylmethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 24526913 |
| Molecular Formula | C22H15N5O3S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 4-(benzimidazolo[1,2-c]quinazolin-6-ylsulfanylmethyl)-3-nitrobenzamide |
| SMILES | NC(=O)c1ccc(CSc2nc3ccccc3c3nc4ccccc4n23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H15N5O3S/c23-20(28)13-9-10-14(19(11-13)27(29)30)12-31-22-25-16-6-2-1-5-15(16)21-24-17-7-3-4-8-18(17)26(21)22/h1-11H,12H2,(H2,23,28) |
| InChIKey | AJMHVDHKBXWPDP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|