C14H13N5O5S — CID 24531406
(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl 1-methyl-4-nitropyrrole-2-carboxylate (PubChem CID 24531406) has the molecular formula C14H13N5O5S and a molecular weight of 363.36 g/mol. Its IUPAC name is (2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl 1-methyl-4-nitropyrrole-2-carboxylate.
| Compound Name | (2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl 1-methyl-4-nitropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 24531406 |
| Molecular Formula | C14H13N5O5S |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | (2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl 1-methyl-4-nitropyrrole-2-carboxylate |
| SMILES | CCc1nn2c(=O)cc(COC(=O)c3cc([N+](=O)[O-])cn3C)nc2s1 |
| InChI | InChI=1S/C14H13N5O5S/c1-3-11-16-18-12(20)4-8(15-14(18)25-11)7-24-13(21)10-5-9(19(22)23)6-17(10)2/h4-6H,3,7H2,1-2H3 |
| InChIKey | RLXBJYLGEZNOEG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 121.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|