C22H21N5O3 — CID 24532442
1-methyl-N'-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)butanoyl]indole-3-carbohydrazide (PubChem CID 24532442) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 1-methyl-N'-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)butanoyl]indole-3-carbohydrazide.
| Compound Name | 1-methyl-N'-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)butanoyl]indole-3-carbohydrazide |
|---|---|
| PubChem CID | 24532442 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-methyl-N'-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)butanoyl]indole-3-carbohydrazide |
| SMILES | Cn1cc(C(=O)NNC(=O)CCCc2nc(-c3ccccc3)no2)c2ccccc21 |
| InChI | InChI=1S/C22H21N5O3/c1-27-14-17(16-10-5-6-11-18(16)27)22(29)25-24-19(28)12-7-13-20-23-21(26-30-20)15-8-3-2-4-9-15/h2-6,8-11,14H,7,12-13H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | BHATYXQVDRHXOB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|