C22H21N5O2 — CID 26815658
1-methyl-N'-[3-(1-phenylpyrazol-4-yl)propanoyl]indole-3-carbohydrazide (PubChem CID 26815658) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 1-methyl-N'-[3-(1-phenylpyrazol-4-yl)propanoyl]indole-3-carbohydrazide.
| Compound Name | 1-methyl-N'-[3-(1-phenylpyrazol-4-yl)propanoyl]indole-3-carbohydrazide |
|---|---|
| PubChem CID | 26815658 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1-methyl-N'-[3-(1-phenylpyrazol-4-yl)propanoyl]indole-3-carbohydrazide |
| SMILES | Cn1cc(C(=O)NNC(=O)CCc2cnn(-c3ccccc3)c2)c2ccccc21 |
| InChI | InChI=1S/C22H21N5O2/c1-26-15-19(18-9-5-6-10-20(18)26)22(29)25-24-21(28)12-11-16-13-23-27(14-16)17-7-3-2-4-8-17/h2-10,13-15H,11-12H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | SPRILRYXTSFEQC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|