C21H22N6OS — CID 2453373
3-[4-[[3-(3-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]-N-methylanilino]propanenitrile (PubChem CID 2453373) has the molecular formula C21H22N6OS and a molecular weight of 406.52 g/mol. Its IUPAC name is 3-[4-[[3-(3-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]-N-methylanilino]propanenitrile.
| Compound Name | 3-[4-[[3-(3-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]-N-methylanilino]propanenitrile |
|---|---|
| PubChem CID | 2453373 |
| Molecular Formula | C21H22N6OS |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 3-[4-[[3-(3-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]-N-methylanilino]propanenitrile |
| SMILES | CCOc1cccc(-c2n[nH]c(=S)n2N=Cc2ccc(N(C)CCC#N)cc2)c1 |
| InChI | InChI=1S/C21H22N6OS/c1-3-28-19-7-4-6-17(14-19)20-24-25-21(29)27(20)23-15-16-8-10-18(11-9-16)26(2)13-5-12-22/h4,6-11,14-15H,3,5,13H2,1-2H3,(H,25,29) |
| InChIKey | NWJISTRUSPCFDJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 82.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|