C19H21N5OS — CID 7966152
4-[(Z)-[4-[2-hydroxyethyl(methyl)amino]phenyl]methylideneamino]-3-(4-methylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 7966152) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is 4-[(Z)-[4-[2-hydroxyethyl(methyl)amino]phenyl]methylideneamino]-3-(4-methylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-[4-[2-hydroxyethyl(methyl)amino]phenyl]methylideneamino]-3-(4-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 7966152 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 4-[(Z)-[4-[2-hydroxyethyl(methyl)amino]phenyl]methylideneamino]-3-(4-methylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2/N=C\c2ccc(N(C)CCO)cc2)cc1 |
| InChI | InChI=1S/C19H21N5OS/c1-14-3-7-16(8-4-14)18-21-22-19(26)24(18)20-13-15-5-9-17(10-6-15)23(2)11-12-25/h3-10,13,25H,11-12H2,1-2H3,(H,22,26)/b20-13- |
| InChIKey | JDXDBBHBTYKYDK-MOSHPQCFSA-N |
| XLogP | 3.23 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|