C18H18ClN5OS — CID 9174709
3-(2-chlorophenyl)-4-[(Z)-[4-[2-hydroxyethyl(methyl)amino]phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 9174709) has the molecular formula C18H18ClN5OS and a molecular weight of 387.90 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-4-[(Z)-[4-[2-hydroxyethyl(methyl)amino]phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2-chlorophenyl)-4-[(Z)-[4-[2-hydroxyethyl(methyl)amino]phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9174709 |
| Molecular Formula | C18H18ClN5OS |
| Molecular Weight | 387.90 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 3-(2-chlorophenyl)-4-[(Z)-[4-[2-hydroxyethyl(methyl)amino]phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | CN(CCO)c1ccc(/C=N\n2c(-c3ccccc3Cl)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C18H18ClN5OS/c1-23(10-11-25)14-8-6-13(7-9-14)12-20-24-17(21-22-18(24)26)15-4-2-3-5-16(15)19/h2-9,12,25H,10-11H2,1H3,(H,22,26)/b20-12- |
| InChIKey | GVGWSZWGPGKRPA-NDENLUEZSA-N |
| XLogP | 3.57 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.90 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|