C23H30BrN3O3 — CID 24535262
3-bromo-5-methoxy-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-propoxybenzamide (PubChem CID 24535262) has the molecular formula C23H30BrN3O3 and a molecular weight of 476.42 g/mol. Its IUPAC name is 3-bromo-5-methoxy-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-propoxybenzamide.
| Compound Name | 3-bromo-5-methoxy-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 24535262 |
| Molecular Formula | C23H30BrN3O3 |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 3-bromo-5-methoxy-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-4-propoxybenzamide |
| SMILES | CCCOc1c(Br)cc(C(=O)Nc2ccc(N3CCN(C)CC3)c(C)c2)cc1OC |
| InChI | InChI=1S/C23H30BrN3O3/c1-5-12-30-22-19(24)14-17(15-21(22)29-4)23(28)25-18-6-7-20(16(2)13-18)27-10-8-26(3)9-11-27/h6-7,13-15H,5,8-12H2,1-4H3,(H,25,28) |
| InChIKey | LXBWCWXPVYJTSQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|