C24H26ClN3O4S — CID 24536278
4-chloro-N-[2-(dimethylamino)-2-phenylethyl]-3-[(4-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 24536278) has the molecular formula C24H26ClN3O4S and a molecular weight of 488.01 g/mol. Its IUPAC name is 4-chloro-N-[2-(dimethylamino)-2-phenylethyl]-3-[(4-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | 4-chloro-N-[2-(dimethylamino)-2-phenylethyl]-3-[(4-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 24536278 |
| Molecular Formula | C24H26ClN3O4S |
| Molecular Weight | 488.01 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 4-chloro-N-[2-(dimethylamino)-2-phenylethyl]-3-[(4-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(C(=O)NCC(c3ccccc3)N(C)C)ccc2Cl)cc1 |
| InChI | InChI=1S/C24H26ClN3O4S/c1-28(2)22(17-7-5-4-6-8-17)16-26-24(29)18-9-14-21(25)23(15-18)33(30,31)27-19-10-12-20(32-3)13-11-19/h4-15,22,27H,16H2,1-3H3,(H,26,29) |
| InChIKey | XQWFHINBCKBCEY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.01 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |