C22H21N3O4S — CID 24539175
N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide (PubChem CID 24539175) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide.
| Compound Name | N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 24539175 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCN2C(=O)S/C(=C\c3ccccc3)C2=O)[nH]c2c1C(=O)CCC2 |
| InChI | InChI=1S/C22H21N3O4S/c1-13-18-15(8-5-9-16(18)26)24-19(13)20(27)23-10-11-25-21(28)17(30-22(25)29)12-14-6-3-2-4-7-14/h2-4,6-7,12,24H,5,8-11H2,1H3,(H,23,27)/b17-12- |
| InChIKey | OBTGBGLMUCWDER-ATVHPVEESA-N |
| XLogP | 3.31 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|