C16H14N4O2S — CID 24539331
N-(6-methoxy-3-pyridinyl)-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide (PubChem CID 24539331) has the molecular formula C16H14N4O2S and a molecular weight of 326.38 g/mol. Its IUPAC name is N-(6-methoxy-3-pyridinyl)-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide.
| Compound Name | N-(6-methoxy-3-pyridinyl)-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 24539331 |
| Molecular Formula | C16H14N4O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-(6-methoxy-3-pyridinyl)-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2c[nH]c(=S)n2-c2ccccc2)cn1 |
| InChI | InChI=1S/C16H14N4O2S/c1-22-14-8-7-11(9-17-14)19-15(21)13-10-18-16(23)20(13)12-5-3-2-4-6-12/h2-10H,1H3,(H,18,23)(H,19,21) |
| InChIKey | BRGTYGWTBHKUJV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|