C25H19N7O3 — CID 24540532
N'-[2-(4-oxoquinazolin-3-yl)acetyl]-1,5-diphenyl-1,2,4-triazole-3-carbohydrazide (PubChem CID 24540532) has the molecular formula C25H19N7O3 and a molecular weight of 465.47 g/mol. Its IUPAC name is N'-[2-(4-oxoquinazolin-3-yl)acetyl]-1,5-diphenyl-1,2,4-triazole-3-carbohydrazide.
| Compound Name | N'-[2-(4-oxoquinazolin-3-yl)acetyl]-1,5-diphenyl-1,2,4-triazole-3-carbohydrazide |
|---|---|
| PubChem CID | 24540532 |
| Molecular Formula | C25H19N7O3 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N'-[2-(4-oxoquinazolin-3-yl)acetyl]-1,5-diphenyl-1,2,4-triazole-3-carbohydrazide |
| SMILES | O=C(Cn1cnc2ccccc2c1=O)NNC(=O)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H19N7O3/c33-21(15-31-16-26-20-14-8-7-13-19(20)25(31)35)28-29-24(34)22-27-23(17-9-3-1-4-10-17)32(30-22)18-11-5-2-6-12-18/h1-14,16H,15H2,(H,28,33)(H,29,34) |
| InChIKey | LLSDGAVPYMQBNT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 123.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|