C12H22N4O2 — CID 2454147
6-amino-5-(pentan-3-ylamino)-1-propylpyrimidine-2,4-dione (PubChem CID 2454147) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 6-amino-5-(pentan-3-ylamino)-1-propylpyrimidine-2,4-dione.
| Compound Name | 6-amino-5-(pentan-3-ylamino)-1-propylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2454147 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 6-amino-5-(pentan-3-ylamino)-1-propylpyrimidine-2,4-dione |
| SMILES | CCCn1c(N)c(NC(CC)CC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H22N4O2/c1-4-7-16-10(13)9(11(17)15-12(16)18)14-8(5-2)6-3/h8,14H,4-7,13H2,1-3H3,(H,15,17,18) |
| InChIKey | KGCKJYCEPDGLJT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |