C21H24N6O4S2 — CID 24542916
2-morpholin-4-yl-N'-[3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoyl]-1,3-thiazole-4-carbohydrazide (PubChem CID 24542916) has the molecular formula C21H24N6O4S2 and a molecular weight of 488.60 g/mol. Its IUPAC name is 2-morpholin-4-yl-N'-[3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoyl]-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-morpholin-4-yl-N'-[3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoyl]-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 24542916 |
| Molecular Formula | C21H24N6O4S2 |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 2-morpholin-4-yl-N'-[3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)propanoyl]-1,3-thiazole-4-carbohydrazide |
| SMILES | O=C(CCc1nc2sc3c(c2c(=O)[nH]1)CCCC3)NNC(=O)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C21H24N6O4S2/c28-16(25-26-18(29)13-11-32-21(22-13)27-7-9-31-10-8-27)6-5-15-23-19(30)17-12-3-1-2-4-14(12)33-20(17)24-15/h11H,1-10H2,(H,25,28)(H,26,29)(H,23,24,30) |
| InChIKey | HOSFDIZKPXIHMG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|