C21H21BrN2O5S — CID 24544466
N-[(5-bromo-2-methoxyphenyl)methyl]-4-(furan-2-ylmethylsulfamoyl)-N-methylbenzamide (PubChem CID 24544466) has the molecular formula C21H21BrN2O5S and a molecular weight of 493.38 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methyl]-4-(furan-2-ylmethylsulfamoyl)-N-methylbenzamide.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methyl]-4-(furan-2-ylmethylsulfamoyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 24544466 |
| Molecular Formula | C21H21BrN2O5S |
| Molecular Weight | 493.38 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methyl]-4-(furan-2-ylmethylsulfamoyl)-N-methylbenzamide |
| SMILES | COc1ccc(Br)cc1CN(C)C(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C21H21BrN2O5S/c1-24(14-16-12-17(22)7-10-20(16)28-2)21(25)15-5-8-19(9-6-15)30(26,27)23-13-18-4-3-11-29-18/h3-12,23H,13-14H2,1-2H3 |
| InChIKey | KIABFDDJBZYELN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |