C22H22FNO2 — CID 24545440
(2S)-N-[1-(2-fluorophenyl)ethyl]-2-(6-methoxynaphthalen-2-yl)propanamide (PubChem CID 24545440) has the molecular formula C22H22FNO2 and a molecular weight of 351.42 g/mol. Its IUPAC name is (2S)-N-[1-(2-fluorophenyl)ethyl]-2-(6-methoxynaphthalen-2-yl)propanamide.
| Compound Name | (2S)-N-[1-(2-fluorophenyl)ethyl]-2-(6-methoxynaphthalen-2-yl)propanamide |
|---|---|
| PubChem CID | 24545440 |
| Molecular Formula | C22H22FNO2 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (2S)-N-[1-(2-fluorophenyl)ethyl]-2-(6-methoxynaphthalen-2-yl)propanamide |
| SMILES | COc1ccc2cc([C@H](C)C(=O)NC(C)c3ccccc3F)ccc2c1 |
| InChI | InChI=1S/C22H22FNO2/c1-14(22(25)24-15(2)20-6-4-5-7-21(20)23)16-8-9-18-13-19(26-3)11-10-17(18)12-16/h4-15H,1-3H3,(H,24,25)/t14-,15?/m0/s1 |
| InChIKey | ILRXQEVVLRJKFZ-MLCCFXAWSA-N |
| XLogP | 4.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |