C22H22FNO2 — CID 25316643
(2S)-N-[(3-fluoro-4-methylphenyl)methyl]-2-(6-methoxynaphthalen-2-yl)propanamide (PubChem CID 25316643) has the molecular formula C22H22FNO2 and a molecular weight of 351.42 g/mol. Its IUPAC name is (2S)-N-[(3-fluoro-4-methylphenyl)methyl]-2-(6-methoxynaphthalen-2-yl)propanamide.
| Compound Name | (2S)-N-[(3-fluoro-4-methylphenyl)methyl]-2-(6-methoxynaphthalen-2-yl)propanamide |
|---|---|
| PubChem CID | 25316643 |
| Molecular Formula | C22H22FNO2 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (2S)-N-[(3-fluoro-4-methylphenyl)methyl]-2-(6-methoxynaphthalen-2-yl)propanamide |
| SMILES | COc1ccc2cc([C@H](C)C(=O)NCc3ccc(C)c(F)c3)ccc2c1 |
| InChI | InChI=1S/C22H22FNO2/c1-14-4-5-16(10-21(14)23)13-24-22(25)15(2)17-6-7-19-12-20(26-3)9-8-18(19)11-17/h4-12,15H,13H2,1-3H3,(H,24,25)/t15-/m0/s1 |
| InChIKey | OKVISHGLXYLQKO-HNNXBMFYSA-N |
| XLogP | 4.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |