C21H23N3O4S — CID 42945932
2-(6-methoxynaphthalen-2-yl)-N-[[3-(sulfamoylamino)phenyl]methyl]propanamide (PubChem CID 42945932) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is 2-(6-methoxynaphthalen-2-yl)-N-[[3-(sulfamoylamino)phenyl]methyl]propanamide.
| Compound Name | 2-(6-methoxynaphthalen-2-yl)-N-[[3-(sulfamoylamino)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 42945932 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2-(6-methoxynaphthalen-2-yl)-N-[[3-(sulfamoylamino)phenyl]methyl]propanamide |
| SMILES | COc1ccc2cc(C(C)C(=O)NCc3cccc(NS(N)(=O)=O)c3)ccc2c1 |
| InChI | InChI=1S/C21H23N3O4S/c1-14(16-6-7-18-12-20(28-2)9-8-17(18)11-16)21(25)23-13-15-4-3-5-19(10-15)24-29(22,26)27/h3-12,14,24H,13H2,1-2H3,(H,23,25)(H2,22,26,27) |
| InChIKey | UWUBOTAQVPBKJQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |