C19H16ClF3N4OS — CID 24545535
2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[1-[3-(trifluoromethyl)phenyl]ethyl]acetamide (PubChem CID 24545535) has the molecular formula C19H16ClF3N4OS and a molecular weight of 440.88 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[1-[3-(trifluoromethyl)phenyl]ethyl]acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[1-[3-(trifluoromethyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 24545535 |
| Molecular Formula | C19H16ClF3N4OS |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[1-[3-(trifluoromethyl)phenyl]ethyl]acetamide |
| SMILES | CC(NC(=O)Cn1c(-c2ccc(Cl)cc2)n[nH]c1=S)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16ClF3N4OS/c1-11(13-3-2-4-14(9-13)19(21,22)23)24-16(28)10-27-17(25-26-18(27)29)12-5-7-15(20)8-6-12/h2-9,11H,10H2,1H3,(H,24,28)(H,26,29) |
| InChIKey | ABIGTNLQQWQGTC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|