C24H32FN3O3 — CID 24547641
N-(4-fluorophenyl)-2-[4-[2-(3-hydroxy-1-adamantyl)acetyl]piperazin-1-yl]acetamide (PubChem CID 24547641) has the molecular formula C24H32FN3O3 and a molecular weight of 429.54 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-[2-(3-hydroxy-1-adamantyl)acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[4-[2-(3-hydroxy-1-adamantyl)acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 24547641 |
| Molecular Formula | C24H32FN3O3 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-[2-(3-hydroxy-1-adamantyl)acetyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)CC23CC4CC(CC(O)(C4)C2)C3)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H32FN3O3/c25-19-1-3-20(4-2-19)26-21(29)15-27-5-7-28(8-6-27)22(30)14-23-10-17-9-18(11-23)13-24(31,12-17)16-23/h1-4,17-18,31H,5-16H2,(H,26,29) |
| InChIKey | DPGGRZXFNJAJRW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |