C23H26N4O2S — CID 24550650
3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]propanamide (PubChem CID 24550650) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is 3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]propanamide.
| Compound Name | 3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 24550650 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]propanamide |
| SMILES | O=C(CCn1c(=S)[nH]c2ccccc2c1=O)NCc1ccc(CN2CCCC2)cc1 |
| InChI | InChI=1S/C23H26N4O2S/c28-21(11-14-27-22(29)19-5-1-2-6-20(19)25-23(27)30)24-15-17-7-9-18(10-8-17)16-26-12-3-4-13-26/h1-2,5-10H,3-4,11-16H2,(H,24,28)(H,25,30) |
| InChIKey | ZYEAUHLGEUTIJU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|