C21H22N4O3S — CID 27760595
N-[2-(2,6-dimethylanilino)-2-oxoethyl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide (PubChem CID 27760595) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is N-[2-(2,6-dimethylanilino)-2-oxoethyl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide.
| Compound Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide |
|---|---|
| PubChem CID | 27760595 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide |
| SMILES | Cc1cccc(C)c1NC(=O)CNC(=O)CCn1c(=S)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C21H22N4O3S/c1-13-6-5-7-14(2)19(13)24-18(27)12-22-17(26)10-11-25-20(28)15-8-3-4-9-16(15)23-21(25)29/h3-9H,10-12H2,1-2H3,(H,22,26)(H,23,29)(H,24,27) |
| InChIKey | ZZCMRQOKAMFKGB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|