C18H16N4O3S — CID 3665092
N-(2,6-dimethylphenyl)-N'-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)oxamide (PubChem CID 3665092) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-N'-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)oxamide.
| Compound Name | N-(2,6-dimethylphenyl)-N'-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)oxamide |
|---|---|
| PubChem CID | 3665092 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-(2,6-dimethylphenyl)-N'-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)oxamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(=O)Nn1c(=S)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C18H16N4O3S/c1-10-6-5-7-11(2)14(10)20-15(23)16(24)21-22-17(25)12-8-3-4-9-13(12)19-18(22)26/h3-9H,1-2H3,(H,19,26)(H,20,23)(H,21,24) |
| InChIKey | OHIJLEFDOAPOON-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|