C22H22N6O3S — CID 24554218
N'-[3-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]-1-methylindole-3-carbohydrazide (PubChem CID 24554218) has the molecular formula C22H22N6O3S and a molecular weight of 450.52 g/mol. Its IUPAC name is N'-[3-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]-1-methylindole-3-carbohydrazide.
| Compound Name | N'-[3-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]-1-methylindole-3-carbohydrazide |
|---|---|
| PubChem CID | 24554218 |
| Molecular Formula | C22H22N6O3S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N'-[3-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]-1-methylindole-3-carbohydrazide |
| SMILES | COc1ccc(-c2n[nH]c(=S)n2CCC(=O)NNC(=O)c2cn(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C22H22N6O3S/c1-27-13-17(16-5-3-4-6-18(16)27)21(30)25-23-19(29)11-12-28-20(24-26-22(28)32)14-7-9-15(31-2)10-8-14/h3-10,13H,11-12H2,1-2H3,(H,23,29)(H,25,30)(H,26,32) |
| InChIKey | ZMTYZUBIIIJLFF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|