C21H19N5O2S — CID 78821919
3-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-quinolin-5-ylpropanamide (PubChem CID 78821919) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is 3-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-quinolin-5-ylpropanamide.
| Compound Name | 3-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-quinolin-5-ylpropanamide |
|---|---|
| PubChem CID | 78821919 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 3-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-quinolin-5-ylpropanamide |
| SMILES | COc1ccc(-c2n[nH]c(=S)n2CCC(=O)Nc2cccc3ncccc23)cc1 |
| InChI | InChI=1S/C21H19N5O2S/c1-28-15-9-7-14(8-10-15)20-24-25-21(29)26(20)13-11-19(27)23-18-6-2-5-17-16(18)4-3-12-22-17/h2-10,12H,11,13H2,1H3,(H,23,27)(H,25,29) |
| InChIKey | ZEMSSRULGPDEAL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|