C23H27N5O2S — CID 78838665
3-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-piperidin-1-ylphenyl)propanamide (PubChem CID 78838665) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is 3-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-piperidin-1-ylphenyl)propanamide.
| Compound Name | 3-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-piperidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 78838665 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 3-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-piperidin-1-ylphenyl)propanamide |
| SMILES | COc1ccc(-c2n[nH]c(=S)n2CCC(=O)Nc2ccccc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H27N5O2S/c1-30-18-11-9-17(10-12-18)22-25-26-23(31)28(22)16-13-21(29)24-19-7-3-4-8-20(19)27-14-5-2-6-15-27/h3-4,7-12H,2,5-6,13-16H2,1H3,(H,24,29)(H,26,31) |
| InChIKey | YGHVUDBJPXYIMC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|