C21H24N4O2S2 — CID 24555636
N-[4-[5-(acetamidomethyl)thiophen-2-yl]-1,3-thiazol-2-yl]-3-[4-(dimethylamino)phenyl]propanamide (PubChem CID 24555636) has the molecular formula C21H24N4O2S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is N-[4-[5-(acetamidomethyl)thiophen-2-yl]-1,3-thiazol-2-yl]-3-[4-(dimethylamino)phenyl]propanamide.
| Compound Name | N-[4-[5-(acetamidomethyl)thiophen-2-yl]-1,3-thiazol-2-yl]-3-[4-(dimethylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 24555636 |
| Molecular Formula | C21H24N4O2S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-[4-[5-(acetamidomethyl)thiophen-2-yl]-1,3-thiazol-2-yl]-3-[4-(dimethylamino)phenyl]propanamide |
| SMILES | CC(=O)NCc1ccc(-c2csc(NC(=O)CCc3ccc(N(C)C)cc3)n2)s1 |
| InChI | InChI=1S/C21H24N4O2S2/c1-14(26)22-12-17-9-10-19(29-17)18-13-28-21(23-18)24-20(27)11-6-15-4-7-16(8-5-15)25(2)3/h4-5,7-10,13H,6,11-12H2,1-3H3,(H,22,26)(H,23,24,27) |
| InChIKey | OYOJUTPJUXTVTG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|