C22H22N4O4S2 — CID 55756627
N-[4-[5-(acetamidomethyl)thiophen-2-yl]-1,3-thiazol-2-yl]-4-(4-cyano-2-methoxyphenoxy)butanamide (PubChem CID 55756627) has the molecular formula C22H22N4O4S2 and a molecular weight of 470.58 g/mol. Its IUPAC name is N-[4-[5-(acetamidomethyl)thiophen-2-yl]-1,3-thiazol-2-yl]-4-(4-cyano-2-methoxyphenoxy)butanamide.
| Compound Name | N-[4-[5-(acetamidomethyl)thiophen-2-yl]-1,3-thiazol-2-yl]-4-(4-cyano-2-methoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 55756627 |
| Molecular Formula | C22H22N4O4S2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | N-[4-[5-(acetamidomethyl)thiophen-2-yl]-1,3-thiazol-2-yl]-4-(4-cyano-2-methoxyphenoxy)butanamide |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)Nc1nc(-c2ccc(CNC(C)=O)s2)cs1 |
| InChI | InChI=1S/C22H22N4O4S2/c1-14(27)24-12-16-6-8-20(32-16)17-13-31-22(25-17)26-21(28)4-3-9-30-18-7-5-15(11-23)10-19(18)29-2/h5-8,10,13H,3-4,9,12H2,1-2H3,(H,24,27)(H,25,26,28) |
| InChIKey | YXLHZBCAKBIQLQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|