C18H14FN3O2S2 — CID 24556381
(E)-N-[4-(4-acetamido-2-fluorophenyl)-1,3-thiazol-2-yl]-3-thiophen-3-ylprop-2-enamide (PubChem CID 24556381) has the molecular formula C18H14FN3O2S2 and a molecular weight of 387.46 g/mol. Its IUPAC name is (E)-N-[4-(4-acetamido-2-fluorophenyl)-1,3-thiazol-2-yl]-3-thiophen-3-ylprop-2-enamide.
| Compound Name | (E)-N-[4-(4-acetamido-2-fluorophenyl)-1,3-thiazol-2-yl]-3-thiophen-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 24556381 |
| Molecular Formula | C18H14FN3O2S2 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | (E)-N-[4-(4-acetamido-2-fluorophenyl)-1,3-thiazol-2-yl]-3-thiophen-3-ylprop-2-enamide |
| SMILES | CC(=O)Nc1ccc(-c2csc(NC(=O)/C=C/c3ccsc3)n2)c(F)c1 |
| InChI | InChI=1S/C18H14FN3O2S2/c1-11(23)20-13-3-4-14(15(19)8-13)16-10-26-18(21-16)22-17(24)5-2-12-6-7-25-9-12/h2-10H,1H3,(H,20,23)(H,21,22,24)/b5-2+ |
| InChIKey | GAIZFXZTVHFEGE-GORDUTHDSA-N |
| XLogP | 4.62 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|