C25H28N4O3S2 — CID 24558174
N-(cyclopropylcarbamoyl)-2-[[3-(3,4-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]propanamide (PubChem CID 24558174) has the molecular formula C25H28N4O3S2 and a molecular weight of 496.66 g/mol. Its IUPAC name is N-(cyclopropylcarbamoyl)-2-[[3-(3,4-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]propanamide.
| Compound Name | N-(cyclopropylcarbamoyl)-2-[[3-(3,4-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 24558174 |
| Molecular Formula | C25H28N4O3S2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | N-(cyclopropylcarbamoyl)-2-[[3-(3,4-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]propanamide |
| SMILES | Cc1ccc(-n2c(SC(C)C(=O)NC(=O)NC3CC3)nc3sc4c(c3c2=O)CCCC4)cc1C |
| InChI | InChI=1S/C25H28N4O3S2/c1-13-8-11-17(12-14(13)2)29-23(31)20-18-6-4-5-7-19(18)34-22(20)28-25(29)33-15(3)21(30)27-24(32)26-16-9-10-16/h8,11-12,15-16H,4-7,9-10H2,1-3H3,(H2,26,27,30,32) |
| InChIKey | NBNKLIITFUFZRU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |